EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H27NO |
| Net Charge | 0 |
| Average Mass | 321.464 |
| Monoisotopic Mass | 321.20926 |
| SMILES | [H][C@]12CC[C@]([H])(C[C@H](OC(c3ccccc3)c3ccccc3)C1)N2CC |
| InChI | InChI=1S/C22H27NO/c1-2-23-19-13-14-20(23)16-21(15-19)24-22(17-9-5-3-6-10-17)18-11-7-4-8-12-18/h3-12,19-22H,2,13-16H2,1H3/t19-,20+,21+ |
| InChIKey | PHTMLLGDZBZXMW-AERCQKQUSA-N |
| Roles Classification |
|---|
| Application: | antiparkinson drug A drug used in the treatment of Parkinson's disease. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ethybenztropine (CHEBI:750737) has role antiparkinson drug (CHEBI:48407) |
| ethybenztropine (CHEBI:750737) is a diarylmethane (CHEBI:51614) |
| INN | Source |
|---|---|
| etibenzatropina | WHO MedNet |
| Synonyms | Source |
|---|---|
| Etybenzatropine | ChEMBL |
| UK-738 | ChEMBL |
| Brand Name | Source |
|---|---|
| Panolid | ChEMBL |