EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C35H65O8P |
| Net Charge | 0 |
| Average Mass | 644.871 |
| Monoisotopic Mass | 644.44171 |
| SMILES | [H][C@@](COC(=O)CCCCCCC/C=C\CCCCCC)(COP(=O)(O)O)OC(=O)CCCCCCC/C=C\CCCCCC |
| InChI | InChI=1S/C35H65O8P/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-34(36)41-31-33(32-42-44(38,39)40)43-35(37)30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h13-16,33H,3-12,17-32H2,1-2H3,(H2,38,39,40)/b15-13-,16-14-/t33-/m1/s1 |
| InChIKey | YLDMPBGXNLGSQO-BFEVMTRQSA-N |
| Roles Classification |
|---|
| Biological Role: | Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1,2-di-[(9Z)-hexadecenoyl]-sn-glycero-3-phosphate (CHEBI:75071) has functional parent palmitoleic acid (CHEBI:28716) |
| 1,2-di-[(9Z)-hexadecenoyl]-sn-glycero-3-phosphate (CHEBI:75071) is a 1,2-diacyl-sn-glycerol 3-phosphate (CHEBI:29089) |
| 1,2-di-[(9Z)-hexadecenoyl]-sn-glycero-3-phosphate (CHEBI:75071) is conjugate acid of 1,2-di-[(9Z)-hexadecenoyl]-sn-glycero-3-phosphate(2−) (CHEBI:74695) |
| Incoming Relation(s) |
| 1,2-di-[(9Z)-hexadecenoyl]-sn-glycero-3-phosphate(2−) (CHEBI:74695) is conjugate base of 1,2-di-[(9Z)-hexadecenoyl]-sn-glycero-3-phosphate (CHEBI:75071) |
| IUPAC Name |
|---|
| (2R)-3-(phosphonooxy)propane-1,2-diyl (9Z,9'Z)bis-hexadec-9-enoate |
| Synonyms | Source |
|---|---|
| 1,2-di-(9Z-hexadecenoyl)-sn-glycero-3-phosphate | LIPID MAPS |
| 1,2-dipalmitoleoyl-sn-glycerol 3-phosphate | ChEBI |
| PA(16:1(9Z)/16:1(9Z)) | LIPID MAPS |
| Manual Xrefs | Databases |
|---|---|
| LMGP10010969 | LIPID MAPS |