EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H28O |
| Net Charge | 0 |
| Average Mass | 284.443 |
| Monoisotopic Mass | 284.21402 |
| SMILES | [H][C@@]12CCC3=CC(=O)C[C@H](C)[C@]3(C)[C@@]1([H])CC[C@]1(C)C=CC[C@@]21[H] |
| InChI | InChI=1S/C20H28O/c1-13-11-15(21)12-14-6-7-16-17-5-4-9-19(17,2)10-8-18(16)20(13,14)3/h4,9,12-13,16-18H,5-8,10-11H2,1-3H3/t13-,16-,17-,18-,19-,20-/m0/s1 |
| InChIKey | GDONNNQFENTLQC-VWTPSIDOSA-N |
| Roles Classification |
|---|
| Biological Role: | androgen A sex hormone that stimulates or controls the development and maintenance of masculine characteristics in vertebrates by binding to androgen receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| delanterone (CHEBI:750708) has role androgen (CHEBI:50113) |
| delanterone (CHEBI:750708) is a 3-hydroxy steroid (CHEBI:36834) |
| INNs | Source |
|---|---|
| delanterona | WHO MedNet |
| delanterone | WHO MedNet |