EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:750684 - clorethate
| Formula | C5H4Cl6O3 |
| Net Charge | 0 |
| Average Mass | 324.802 |
| Monoisotopic Mass | 321.82916 |
| SMILES | O=C(OCC(Cl)(Cl)Cl)OCC(Cl)(Cl)Cl |
| InChI | InChI=1S/C5H4Cl6O3/c6-4(7,8)1-13-3(12)14-2-5(9,10)11/h1-2H2 |
| InChIKey | IEPBPSSCIZTJIF-UHFFFAOYSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| clorethate (CHEBI:750684) is a carbonate ester (CHEBI:46722) |
| INNs | Source |
|---|---|
| cloretate | WHO MedNet |
| cloretato | WHO MedNet |
| Synonyms | Source |
|---|---|
| Chlorethate | ChEMBL |
| Clorethate | ChEMBL |
| NSC-15887 | ChEMBL |
| SK&F 12866 | ChEMBL |
| SK&F-12866 | ChEMBL |