EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:750676 - ceftioxide
| Formula | C16H17N5O8S2 |
| Net Charge | 0 |
| Average Mass | 471.473 |
| Monoisotopic Mass | 471.05185 |
| SMILES | [H][C@@]12[C@H](NC(=O)/C(=N\OC)c3csc(N)n3)C(=O)N1C(C(=O)O)=C(COC(C)=O)C[S+]2[O-] |
| InChI | InChI=1S/C16H17N5O8S2/c1-6(22)29-3-7-5-31(27)14-10(13(24)21(14)11(7)15(25)26)19-12(23)9(20-28-2)8-4-30-16(17)18-8/h4,10,14H,3,5H2,1-2H3,(H2,17,18)(H,19,23)(H,25,26)/b20-9-/t10-,14-,31?/m1/s1 |
| InChIKey | MMQXRUYUBYWTDP-LNXFEASCSA-N |
| Roles Classification |
|---|
| Biological Roles: | drug allergen Any drug which causes the onset of an allergic reaction. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Applications: | drug allergen Any drug which causes the onset of an allergic reaction. antiinfective agent A substance used in the prophylaxis or therapy of infectious diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ceftioxide (CHEBI:750676) is a cephalosporin (CHEBI:23066) |
| INNs | Source |
|---|---|
| ceftioxide | WHO MedNet |
| ceftioxido | WHO MedNet |