EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:750672 - cefetrizole
| Formula | C16H15N5O4S3 |
| Net Charge | 0 |
| Average Mass | 437.528 |
| Monoisotopic Mass | 437.02862 |
| SMILES | [H][C@]12SCC(CSc3ncnn3)=C(C(=O)O)N1C(=O)[C@H]2NC(=O)Cc1cccs1 |
| InChI | InChI=1S/C16H15N5O4S3/c22-10(4-9-2-1-3-26-9)19-11-13(23)21-12(15(24)25)8(5-27-14(11)21)6-28-16-17-7-18-20-16/h1-3,7,11,14H,4-6H2,(H,19,22)(H,24,25)(H,17,18,20)/t11-,14-/m1/s1 |
| InChIKey | UQWYUAURRDNBKR-BXUZGUMPSA-N |
| Roles Classification |
|---|
| Biological Roles: | drug allergen Any drug which causes the onset of an allergic reaction. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Applications: | drug allergen Any drug which causes the onset of an allergic reaction. antiinfective agent A substance used in the prophylaxis or therapy of infectious diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cefetrizole (CHEBI:750672) is a cephalosporin (CHEBI:23066) |
| INNs | Source |
|---|---|
| cefetrizol | WHO MedNet |
| cefetrizole | WHO MedNet |