EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | Na.C9H6INO4S.CHO3 |
| Net Charge | 0 |
| Average Mass | 435.127 |
| Monoisotopic Mass | 434.88856 |
| SMILES | O=C([O-])O.O=S(=O)(O)c1cc(I)c(O)c2ncccc12.[Na+] |
| InChI | InChI=1S/C9H6INO4S.CH2O3.Na/c10-6-4-7(16(13,14)15)5-2-1-3-11-8(5)9(6)12;2-1(3)4;/h1-4,12H,(H,13,14,15);(H2,2,3,4);/q;;+1/p-1 |
| InChIKey | FNXKBSAUKFCXIK-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Application: | antiamoebic agent An antiparasitic agent which is effective against amoeba, a genus of single-celled amoeboids in the family Amoebidae. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| chiniofon (CHEBI:750653) has role antiamoebic agent (CHEBI:171664) |
| chiniofon (CHEBI:750653) is a organohalogen compound (CHEBI:17792) |
| chiniofon (CHEBI:750653) is a quinolines (CHEBI:26513) |
| INN | Source |
|---|---|
| quiniofon | WHO MedNet |
| Synonyms | Source |
|---|---|
| Chiniofon | ChEMBL |
| NSC-758879 | ChEMBL |