EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:750636 - clidafidine
| Formula | C9H8Cl2N2O |
| Net Charge | 0 |
| Average Mass | 231.082 |
| Monoisotopic Mass | 230.00137 |
| SMILES | Clc1cccc(Cl)c1/N=C1/NCCO1 |
| InChI | InChI=1S/C9H8Cl2N2O/c10-6-2-1-3-7(11)8(6)13-9-12-4-5-14-9/h1-3H,4-5H2,(H,12,13) |
| InChIKey | LZQLXSNYZUENIF-UHFFFAOYSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| clidafidine (CHEBI:750636) is a dichlorobenzene (CHEBI:23697) |
| INNs | Source |
|---|---|
| clidafidina | WHO MedNet |
| clidafidine | WHO MedNet |