EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H6N4O2 |
| Net Charge | 0 |
| Average Mass | 178.151 |
| Monoisotopic Mass | 178.04908 |
| SMILES | CC(=O)Nn1cnc(=O)c(C#N)c1 |
| InChI | InChI=1S/C7H6N4O2/c1-5(12)10-11-3-6(2-8)7(13)9-4-11/h3-4H,1H3,(H,10,12) |
| InChIKey | WMJNWYCBXNTPQN-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ciapilome (CHEBI:750632) is a 9,11,15-octadecatrienoic acid (CHEBI:38387) |
| INNs | Source |
|---|---|
| ciapiloma | WHO MedNet |
| ciapilome | WHO MedNet |