EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:750629 - cotarnine chloride
| Formula | Cl.C12H14NO3 |
| Net Charge | 0 |
| Average Mass | 255.701 |
| Monoisotopic Mass | 255.06622 |
| SMILES | COc1c2c(cc3c1OCO3)CC[N+](C)=C2.[Cl-] |
| InChI | InChI=1S/C12H14NO3.ClH/c1-13-4-3-8-5-10-12(16-7-15-10)11(14-2)9(8)6-13;/h5-6H,3-4,7H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | BWQAGVANIBSWBW-UHFFFAOYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cotarnine chloride (CHEBI:750629) is a isoquinolines (CHEBI:24922) |
| Synonyms | Source |
|---|---|
| Cotarnin chloride | ChEMBL |
| Cotarnine chloride | ChEMBL |
| Cotarnine hydrochloride | ChEMBL |
| Cotarninium chloride | ChEMBL |
| NSC-24824 | ChEMBL |
| Secalysat | ChEMBL |
| Citations |
|---|