EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H14ClNO4S |
| Net Charge | 0 |
| Average Mass | 339.800 |
| Monoisotopic Mass | 339.03321 |
| SMILES | CC(=O)OCOC(=O)c1cscc1Nc1cccc(C)c1Cl |
| InChI | InChI=1S/C15H14ClNO4S/c1-9-4-3-5-12(14(9)16)17-13-7-22-6-11(13)15(19)21-8-20-10(2)18/h3-7,17H,8H2,1-2H3 |
| InChIKey | KMGLZXXYCVKWOP-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| aclantate (CHEBI:750575) is a thiophenecarboxylic acid (CHEBI:48436) |
| INNs | Source |
|---|---|
| aclantate | WHO MedNet |
| aclantato | WHO MedNet |
| Synonyms | Source |
|---|---|
| HOE 473 | ChEMBL |
| HOE-473 | ChEMBL |