EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H34Cl2N6O3S2 |
| Net Charge | 0 |
| Average Mass | 649.670 |
| Monoisotopic Mass | 648.15109 |
| SMILES | O=C(Nc1nc(-c2cc(Cl)cs2)c(N2CCN(C3CCCCC3)CC2)s1)c1cnc(N2CCC(C(=O)O)CC2)c(Cl)c1 |
| InChI | InChI=1S/C29H34Cl2N6O3S2/c30-20-15-23(41-17-20)24-27(37-12-10-35(11-13-37)21-4-2-1-3-5-21)42-29(33-24)34-26(38)19-14-22(31)25(32-16-19)36-8-6-18(7-9-36)28(39)40/h14-18,21H,1-13H2,(H,39,40)(H,33,34,38) |
| InChIKey | OFZJKCQENFPZBH-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | anti-anaemic agent A compound which increases either the number of red cells or the amount of haemoglobin in the blood. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| avatrombopag (CHEBI:750510) has role anti-anaemic agent (CHEBI:75835) |
| avatrombopag (CHEBI:750510) is a N-arylpiperazine (CHEBI:46848) |
| Synonyms | Source |
|---|---|
| Akr-501 | ChEMBL |
| Avatrombopag | ChEMBL |
| E-5501 | ChEMBL |
| E5501 | ChEMBL |
| YM-301477 | ChEMBL |
| YM-477 | ChEMBL |
| Citations |
|---|