EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H41ClN4O5 |
| Net Charge | 0 |
| Average Mass | 537.101 |
| Monoisotopic Mass | 536.27655 |
| SMILES | COc1cc(N)c(Cl)cc1C(=O)N[C@@H]1CCN(CCCCCC(=O)O[C@H]2CN3CCC2CC3)C[C@@H]1OC |
| InChI | InChI=1S/C27H41ClN4O5/c1-35-23-15-21(29)20(28)14-19(23)27(34)30-22-9-13-31(17-25(22)36-2)10-5-3-4-6-26(33)37-24-16-32-11-7-18(24)8-12-32/h14-15,18,22,24-25H,3-13,16-17,29H2,1-2H3,(H,30,34)/t22-,24+,25+/m1/s1 |
| InChIKey | VGDDOIZXGFJDRC-VJTSUQJLSA-N |
| Roles Classification |
|---|
| Application: | gastrointestinal drug A drug used for its effects on the gastrointestinal system, e.g. controlling gastric acidity, regulating gastrointestinal motility and water flow, and improving digestion. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| naronapride (CHEBI:750498) has role gastrointestinal drug (CHEBI:55324) |
| naronapride (CHEBI:750498) is a carbonyl compound (CHEBI:36586) |
| naronapride (CHEBI:750498) is a organohalogen compound (CHEBI:17792) |
| INNs | Source |
|---|---|
| naronaprida | WHO MedNet |
| naronapride | WHO MedNet |
| Synonyms | Source |
|---|---|
| ATI-7505 | ChEMBL |
| ATI7505 | ChEMBL |