EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H19F3N4O3 |
| Net Charge | 0 |
| Average Mass | 456.424 |
| Monoisotopic Mass | 456.14093 |
| SMILES | Cc1cc(F)ccc1-c1nc(NC(CO)CO)nc2c1ccc(=O)n2-c1c(F)cccc1F |
| InChI | InChI=1S/C23H19F3N4O3/c1-12-9-13(24)5-6-15(12)20-16-7-8-19(33)30(21-17(25)3-2-4-18(21)26)22(16)29-23(28-20)27-14(10-31)11-32/h2-9,14,31-32H,10-11H2,1H3,(H,27,28,29) |
| InChIKey | ORVNHOYNEHYKJG-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | antirheumatic drug A drug used to treat rheumatoid arthritis. cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dilmapimod (CHEBI:750491) has role antirheumatic drug (CHEBI:35842) |
| dilmapimod (CHEBI:750491) has role cardiovascular drug (CHEBI:35554) |
| dilmapimod (CHEBI:750491) is a pyridopyrimidine (CHEBI:38932) |
| INN | Source |
|---|---|
| dilmapimod | WHO MedNet |
| Synonyms | Source |
|---|---|
| Gw-681323 | ChEMBL |
| SB-681323 | ChEMBL |
| SB681323 | ChEMBL |