EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H19NO2 |
| Net Charge | 0 |
| Average Mass | 173.256 |
| Monoisotopic Mass | 173.14158 |
| SMILES | CCC[C@@H](C)C[C@H](N)CC(=O)O |
| InChI | InChI=1S/C9H19NO2/c1-3-4-7(2)5-8(10)6-9(11)12/h7-8H,3-6,10H2,1-2H3,(H,11,12)/t7-,8+/m1/s1 |
| InChIKey | JXEHXYFSIOYTAH-SFYZADRCSA-N |
| Roles Classification |
|---|
| Application: | anxiolytic drug Anxiolytic drugs are agents that alleviate anxiety, tension, and anxiety disorders, promote sedation, and have a calming effect without affecting clarity of consciousness or neurologic conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| imagabalin (CHEBI:750490) has functional parent β-amino acid (CHEBI:33706) |
| imagabalin (CHEBI:750490) has role anxiolytic drug (CHEBI:35474) |
| imagabalin (CHEBI:750490) is a organonitrogen compound (CHEBI:35352) |
| imagabalin (CHEBI:750490) is a organooxygen compound (CHEBI:36963) |
| INNs | Source |
|---|---|
| imagabalin | WHO MedNet |
| imagabalina | WHO MedNet |
| imagabaline | WHO MedNet |
| Synonyms | Source |
|---|---|
| PD 0332334 | ChEMBL |
| PD-0332334 | ChEMBL |
| PD0332334 | ChEMBL |
| PF-00195889 | ChEMBL |