EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H15N3O2 |
| Net Charge | 0 |
| Average Mass | 233.271 |
| Monoisotopic Mass | 233.11643 |
| SMILES | CN1CCN(c2cccc3nc(=O)oc23)CC1 |
| InChI | InChI=1S/C12H15N3O2/c1-14-5-7-15(8-6-14)10-4-2-3-9-11(10)17-12(16)13-9/h2-4H,5-8H2,1H3,(H,13,16) |
| InChIKey | YVPUUUDAZYFFQT-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | antiparkinson drug A drug used in the treatment of Parkinson's disease. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pardoprunox (CHEBI:750487) has role antiparkinson drug (CHEBI:48407) |
| pardoprunox (CHEBI:750487) is a N-arylpiperazine (CHEBI:46848) |
| INN | Source |
|---|---|
| pardoprunox | WHO MedNet |
| Synonyms | Source |
|---|---|
| DU 126891 | ChEMBL |
| DU-126891 | ChEMBL |
| DU126891 | ChEMBL |
| SLV 308 | ChEMBL |
| SLV-308 | ChEMBL |
| SLV308 | ChEMBL |