EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H26FN6O9P |
| Net Charge | 0 |
| Average Mass | 580.466 |
| Monoisotopic Mass | 580.14829 |
| SMILES | COc1cc(Nc2ncc(F)c(Nc3ccc4c(n3)N(COP(=O)(O)O)C(=O)C(C)(C)O4)n2)cc(OC)c1OC |
| InChI | InChI=1S/C23H26FN6O9P/c1-23(2)21(31)30(11-38-40(32,33)34)20-14(39-23)6-7-17(28-20)27-19-13(24)10-25-22(29-19)26-12-8-15(35-3)18(37-5)16(9-12)36-4/h6-10H,11H2,1-5H3,(H2,32,33,34)(H2,25,26,27,28,29) |
| InChIKey | GKDRMWXFWHEQQT-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | antiviral agent A substance that destroys or inhibits replication of viruses. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Applications: | anti-anaemic agent A compound which increases either the number of red cells or the amount of haemoglobin in the blood. antirheumatic drug A drug used to treat rheumatoid arthritis. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. antifibrotic agent Any agent which acts to reduce fibrosis. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fostamatinib (CHEBI:750486) has role anti-anaemic agent (CHEBI:75835) |
| fostamatinib (CHEBI:750486) has role antifibrotic agent (CHEBI:233423) |
| fostamatinib (CHEBI:750486) has role antimicrobial agent (CHEBI:33281) |
| fostamatinib (CHEBI:750486) has role antineoplastic agent (CHEBI:35610) |
| fostamatinib (CHEBI:750486) has role antirheumatic drug (CHEBI:35842) |
| fostamatinib (CHEBI:750486) has role antiviral agent (CHEBI:22587) |
| fostamatinib (CHEBI:750486) is a methoxybenzenes (CHEBI:51683) |
| Synonyms | Source |
|---|---|
| Fostamatinib | ChEMBL |
| R-788 | ChEMBL |
| R-788 FREE ACID | ChEMBL |
| R788 FREE ACID | ChEMBL |
| R-935788 | ChEMBL |
| R-935788 FREE ACID | ChEMBL |
| Citations |
|---|