EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H15ClFN5O5S2 |
| Net Charge | 0 |
| Average Mass | 523.955 |
| Monoisotopic Mass | 523.01872 |
| SMILES | CNc1cc2nc(=O)n(-c3ccc(NC(=O)NS(=O)(=O)c4ccc(Cl)s4)cc3)c(=O)c2cc1F |
| InChI | InChI=1S/C20H15ClFN5O5S2/c1-23-15-9-14-12(8-13(15)22)18(28)27(20(30)25-14)11-4-2-10(3-5-11)24-19(29)26-34(31,32)17-7-6-16(21)33-17/h2-9,23H,1H3,(H,25,30)(H2,24,26,29) |
| InChIKey | LGSDFTPAICUONK-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. renoprotective agent Any compound that is able to prevent damage to the kidneys. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| elinogrel (CHEBI:750484) has role cardiovascular drug (CHEBI:35554) |
| elinogrel (CHEBI:750484) has role renoprotective agent (CHEBI:231911) |
| elinogrel (CHEBI:750484) is a quinazolines (CHEBI:38530) |
| INN | Source |
|---|---|
| elinogrel | WHO MedNet |
| Synonyms | Source |
|---|---|
| Prt060128 | ChEMBL |
| PRT 060128 | ChEMBL |
| PRT-060128 | ChEMBL |
| Citations |
|---|