EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:750483 - arhalofenate
| Formula | C19H17ClF3NO4 |
| Net Charge | 0 |
| Average Mass | 415.795 |
| Monoisotopic Mass | 415.07982 |
| SMILES | CC(=O)NCCOC(=O)[C@H](Oc1cccc(C(F)(F)F)c1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H17ClF3NO4/c1-12(25)24-9-10-27-18(26)17(13-5-7-15(20)8-6-13)28-16-4-2-3-14(11-16)19(21,22)23/h2-8,11,17H,9-10H2,1H3,(H,24,25)/t17-/m1/s1 |
| InChIKey | BJBCSGQLZQGGIQ-QGZVFWFLSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Applications: | hypoglycemic agent A drug which lowers the blood glucose level. gout suppressant A drug that increases uric acid excretion by the kidney (uricosuric drug), decreases uric acid production (antihyperuricemic), or alleviates the pain and inflammation of acute attacks of gout. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| arhalofenate (CHEBI:750483) has role gout suppressant (CHEBI:35845) |
| arhalofenate (CHEBI:750483) has role hypoglycemic agent (CHEBI:35526) |
| arhalofenate (CHEBI:750483) is a monocarboxylic acid (CHEBI:25384) |
| INNs | Source |
|---|---|
| arhalofenate | WHO MedNet |
| arhalofenato | WHO MedNet |
| Synonyms | Source |
|---|---|
| CB-102 | ChEMBL |
| CB102 | ChEMBL |
| JNJ-39659100 | ChEMBL |
| M-102 | ChEMBL |
| M102 | ChEMBL |
| MBX-102 | ChEMBL |
| Citations |
|---|