EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | Na.C11H5BrCl2NO3S2 |
| Net Charge | 0 |
| Average Mass | 437.099 |
| Monoisotopic Mass | 434.81690 |
| SMILES | O=C([N-]S(=O)(=O)c1ccc(Br)s1)c1ccc(Cl)cc1Cl.[Na+] |
| InChI | InChI=1S/C11H6BrCl2NO3S2.Na/c12-9-3-4-10(19-9)20(17,18)15-11(16)7-2-1-6(13)5-8(7)14;/h1-5H,(H,15,16);/q;+1/p-1 |
| InChIKey | JCOHXVDKRMWUQP-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tasisulam sodium (CHEBI:750482) has role antineoplastic agent (CHEBI:35610) |
| tasisulam sodium (CHEBI:750482) is a carbonyl compound (CHEBI:36586) |
| tasisulam sodium (CHEBI:750482) is a organohalogen compound (CHEBI:17792) |
| Synonyms | Source |
|---|---|
| LY-573636.NA | ChEMBL |
| LY-573636NA | ChEMBL |
| LY-573636 SODIUM | ChEMBL |
| Tasisulam sodium | ChEMBL |