EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H34F2O5 |
| Net Charge | 0 |
| Average Mass | 404.494 |
| Monoisotopic Mass | 404.23743 |
| SMILES | [H][C@@]12CC(=O)[C@H](CCCCCCC(=O)O)[C@@]1([H])CC[C@](O)(C(F)(F)C[C@@H](C)CC)O2 |
| InChI | InChI=1S/C21H34F2O5/c1-3-14(2)13-20(22,23)21(27)11-10-16-15(17(24)12-18(16)28-21)8-6-4-5-7-9-19(25)26/h14-16,18,27H,3-13H2,1-2H3,(H,25,26)/t14-,15+,16+,18+,21+/m0/s1 |
| InChIKey | SDDSJMXGJNWMJY-BRHAQHMBSA-N |
| Roles Classification |
|---|
| Applications: | anti-ulcer drug One of various classes of drugs with different action mechanisms used to treat or ameliorate peptic ulcer or irritation of the gastrointestinal tract. anti-inflammatory agent Any compound that has anti-inflammatory effects. antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cobiprostone (CHEBI:750472) has role anti-inflammatory agent (CHEBI:67079) |
| cobiprostone (CHEBI:750472) has role anti-ulcer drug (CHEBI:49201) |
| cobiprostone (CHEBI:750472) has role antihypertensive agent (CHEBI:35674) |
| cobiprostone (CHEBI:750472) is a prostanoid (CHEBI:26347) |
| INNs | Source |
|---|---|
| cobiprostona | WHO MedNet |
| cobiprostone | WHO MedNet |
| Synonyms | Source |
|---|---|
| RU-8811 | ChEMBL |
| SPI-8811 | ChEMBL |