EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H34F2O5 |
| Net Charge | 0 |
| Average Mass | 404.494 |
| Monoisotopic Mass | 404.23743 |
| SMILES | [H][C@@]12CC(=O)[C@H](CCCCCCC(=O)O)[C@@]1([H])CC[C@](O)(C(F)(F)C[C@@H](C)CC)O2 |
| InChI | InChI=1S/C21H34F2O5/c1-3-14(2)13-20(22,23)21(27)11-10-16-15(17(24)12-18(16)28-21)8-6-4-5-7-9-19(25)26/h14-16,18,27H,3-13H2,1-2H3,(H,25,26)/t14-,15+,16+,18+,21+/m0/s1 |
| InChIKey | SDDSJMXGJNWMJY-BRHAQHMBSA-N |
| Roles Classification |
|---|
| Applications: | anti-ulcer drug One of various classes of drugs with different action mechanisms used to treat or ameliorate peptic ulcer or irritation of the gastrointestinal tract. antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cobiprostone (CHEBI:750472) has role anti-inflammatory agent (CHEBI:67079) |
| cobiprostone (CHEBI:750472) has role anti-ulcer drug (CHEBI:49201) |
| cobiprostone (CHEBI:750472) has role antihypertensive agent (CHEBI:35674) |
| cobiprostone (CHEBI:750472) is a prostanoid (CHEBI:26347) |
| INNs | Source |
|---|---|
| cobiprostona | WHO MedNet |
| cobiprostone | WHO MedNet |
| Synonyms | Source |
|---|---|
| RU-8811 | ChEMBL |
| SPI-8811 | ChEMBL |