EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H42N6O3.HCl |
| Net Charge | 0 |
| Average Mass | 583.177 |
| Monoisotopic Mass | 582.30852 |
| SMILES | CN(C)N(C)C(=O)[C@@]1(Cc2ccccc2)CCCN(C(=O)[C@@H](Cc2cnc3ccccc23)NC(=O)C(C)(C)N)C1.Cl |
| InChI | InChI=1S/C31H42N6O3.ClH/c1-30(2,32)28(39)34-26(18-23-20-33-25-15-10-9-14-24(23)25)27(38)37-17-11-16-31(21-37,29(40)36(5)35(3)4)19-22-12-7-6-8-13-22;/h6-10,12-15,20,26,33H,11,16-19,21,32H2,1-5H3,(H,34,39);1H/t26-,31-;/m1./s1 |
| InChIKey | VFYAEUWJFGTGGO-GHTUPXNNSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| anamorelin hydrochloride (CHEBI:750468) has role antineoplastic agent (CHEBI:35610) |
| anamorelin hydrochloride (CHEBI:750468) is a dipeptide (CHEBI:46761) |
| Synonyms | Source |
|---|---|
| Anamorelin hcl | ChEMBL |
| Anamorelin hydrochloride | ChEMBL |
| Ono-7643 | ChEMBL |
| RC-1291 HCl | ChEMBL |