EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H28N4O5 |
| Net Charge | 0 |
| Average Mass | 416.478 |
| Monoisotopic Mass | 416.20597 |
| SMILES | COC(=O)N1CC2(CC2)C[C@H](C(=O)NO)[C@H]1C(=O)N1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C21H28N4O5/c1-30-20(28)25-14-21(7-8-21)13-16(18(26)22-29)17(25)19(27)24-11-9-23(10-12-24)15-5-3-2-4-6-15/h2-6,16-17,29H,7-14H2,1H3,(H,22,26)/t16-,17-/m0/s1 |
| InChIKey | DJXMSZSZEIKLQZ-IRXDYDNUSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| aderbasib (CHEBI:750464) has role antineoplastic agent (CHEBI:35610) |
| aderbasib (CHEBI:750464) is a piperazines (CHEBI:26144) |
| INN | Source |
|---|---|
| aderbasib | WHO MedNet |
| Synonyms | Source |
|---|---|
| INCB 007839 | ChEMBL |
| INCB-007839 | ChEMBL |
| INCB007839 | ChEMBL |