EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H9Cl2NO2 |
| Net Charge | 0 |
| Average Mass | 234.082 |
| Monoisotopic Mass | 233.00103 |
| SMILES | CN(C(=O)C(Cl)Cl)c1ccc(O)cc1 |
| InChI | InChI=1S/C9H9Cl2NO2/c1-12(9(14)8(10)11)6-2-4-7(13)5-3-6/h2-5,8,13H,1H3 |
| InChIKey | GZZZSOOGQLOEOB-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antiamoebic agent An antiparasitic agent which is effective against amoeba, a genus of single-celled amoeboids in the family Amoebidae. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| diloxanide (CHEBI:750458) has role antiamoebic agent (CHEBI:171664) |
| diloxanide (CHEBI:750458) is a anilide (CHEBI:13248) |
| INN | Source |
|---|---|
| diloxanida | WHO MedNet |
| Synonym | Source |
|---|---|
| Diloxanide | ChEMBL |