EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:750437 - dimoxamine hydrochloride
| Formula | HCl.C13H21NO2 |
| Net Charge | 0 |
| Average Mass | 259.777 |
| Monoisotopic Mass | 259.13391 |
| SMILES | CC[C@@H](N)Cc1cc(OC)c(C)cc1OC.Cl |
| InChI | InChI=1S/C13H21NO2.ClH/c1-5-11(14)7-10-8-12(15-3)9(2)6-13(10)16-4;/h6,8,11H,5,7,14H2,1-4H3;1H/t11-;/m1./s1 |
| InChIKey | HQMDHDKBZGKPGS-RFVHGSKJSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | central nervous system stimulant Any drug that enhances the activity of the central nervous system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dimoxamine hydrochloride (CHEBI:750437) is a amphetamines (CHEBI:35338) |
| Synonyms | Source |
|---|---|
| BL-3912A | ChEMBL |
| Dimoxamine hcl | ChEMBL |
| Dimoxamine hydrochloride | ChEMBL |
| Dimoxamine hydrochloride, (r)- | ChEMBL |
| NSC-292248 | ChEMBL |
| Citations |
|---|