EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H21N3O4 |
| Net Charge | 0 |
| Average Mass | 391.427 |
| Monoisotopic Mass | 391.15321 |
| SMILES | C#Cc1cccc(Nc2ncnc3cc4c(cc23)OCCOCCOCCO4)c1 |
| InChI | InChI=1S/C22H21N3O4/c1-2-16-4-3-5-17(12-16)25-22-18-13-20-21(14-19(18)23-15-24-22)29-11-9-27-7-6-26-8-10-28-20/h1,3-5,12-15H,6-11H2,(H,23,24,25) |
| InChIKey | QQLKULDARVNMAL-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. antipsoriatic A drug used to treat psoriasis. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| icotinib (CHEBI:750435) has role antineoplastic agent (CHEBI:35610) |
| icotinib (CHEBI:750435) has role antipsoriatic (CHEBI:50748) |
| icotinib (CHEBI:750435) is a quinazolines (CHEBI:38530) |
| Synonyms | Source |
|---|---|
| Bpi-2009 | ChEMBL |
| Icotinib | ChEMBL |
| Citations |
|---|