EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H36N4O5S |
| Net Charge | 0 |
| Average Mass | 504.653 |
| Monoisotopic Mass | 504.24064 |
| SMILES | [H][C@]12CC[C@]([H])(C[C@H](NC(=O)c3cc4ccccc4n(C(C)C)c3=O)C1)N2C[C@@H](O)CN(C)S(C)(=O)=O |
| InChI | InChI=1S/C25H36N4O5S/c1-16(2)29-23-8-6-5-7-17(23)11-22(25(29)32)24(31)26-18-12-19-9-10-20(13-18)28(19)15-21(30)14-27(3)35(4,33)34/h5-8,11,16,18-21,30H,9-10,12-15H2,1-4H3,(H,26,31)/t18-,19+,20-,21-/m0/s1 |
| InChIKey | HXLOHDZQBKCUCR-WOZUAGRISA-N |
| Roles Classification |
|---|
| Application: | gastrointestinal drug A drug used for its effects on the gastrointestinal system, e.g. controlling gastric acidity, regulating gastrointestinal motility and water flow, and improving digestion. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| velusetrag (CHEBI:750434) has role gastrointestinal drug (CHEBI:55324) |
| velusetrag (CHEBI:750434) is a aromatic amide (CHEBI:62733) |
| velusetrag (CHEBI:750434) is a quinolines (CHEBI:26513) |
| INN | Source |
|---|---|
| velusetrag | WHO MedNet |
| Synonym | Source |
|---|---|
| TD-5108 | ChEMBL |
| Citations |
|---|