EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H34O4 |
| Net Charge | 0 |
| Average Mass | 374.521 |
| Monoisotopic Mass | 374.24571 |
| SMILES | [H][C@]12CC[C@]3([H])[C@]([H])(CC[C@@]4(C)[C@]3(O)CC[C@]4(O)c3ccoc3)[C@@]1(C)CC[C@H](O)C2 |
| InChI | InChI=1S/C23H34O4/c1-20-8-5-17(24)13-15(20)3-4-19-18(20)6-9-21(2)22(25,10-11-23(19,21)26)16-7-12-27-14-16/h7,12,14-15,17-19,24-26H,3-6,8-11,13H2,1-2H3/t15-,17+,18+,19-,20+,21-,22+,23+/m1/s1 |
| InChIKey | AEAPORIZZWBIEX-DTBDINHYSA-N |
| Roles Classification |
|---|
| Application: | antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| rostafuroxin (CHEBI:750422) has role antihypertensive agent (CHEBI:35674) |
| rostafuroxin (CHEBI:750422) is a steroid (CHEBI:35341) |
| INNs | Source |
|---|---|
| rostafuroxin | WHO MedNet |
| rostafuroxina | WHO MedNet |
| rostafuroxine | WHO MedNet |
| Citations |
|---|