EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:750415 - vonoprazan fumarate
| Formula | C17H16FN3O2S.C4H4O4 |
| Net Charge | 0 |
| Average Mass | 461.471 |
| Monoisotopic Mass | 461.10568 |
| SMILES | CNCc1cc(-c2ccccc2F)n(S(=O)(=O)c2cccnc2)c1.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C17H16FN3O2S.C4H4O4/c1-19-10-13-9-17(15-6-2-3-7-16(15)18)21(12-13)24(22,23)14-5-4-8-20-11-14;5-3(6)1-2-4(7)8/h2-9,11-12,19H,10H2,1H3;1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | ROGSHYHKHPCCJW-WLHGVMLRSA-N |
| Roles Classification |
|---|
| Biological Role: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| Application: | anti-ulcer drug One of various classes of drugs with different action mechanisms used to treat or ameliorate peptic ulcer or irritation of the gastrointestinal tract. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| vonoprazan fumarate (CHEBI:750415) has role anti-ulcer drug (CHEBI:49201) |
| vonoprazan fumarate (CHEBI:750415) has role antibacterial agent (CHEBI:33282) |
| vonoprazan fumarate (CHEBI:750415) is a pyridines (CHEBI:26421) |
| vonoprazan fumarate (CHEBI:750415) is a sulfonamide (CHEBI:35358) |
| Synonyms | Source |
|---|---|
| Tak 438 | ChEMBL |
| TAK-438 monofumarate | ChEMBL |
| Vonoprazan monofumarate | ChEMBL |
| Voquezna | ChEMBL |
| Citations |
|---|