EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H34N6O3S |
| Net Charge | 0 |
| Average Mass | 498.653 |
| Monoisotopic Mass | 498.24131 |
| SMILES | [H][C@@]1(C(=O)Nc2snnc2-c2ccccc2)CCCN1C(=O)[C@@H](NC(=O)[C@H](C)NC)C1CCCCC1 |
| InChI | InChI=1S/C25H34N6O3S/c1-16(26-2)22(32)27-21(18-12-7-4-8-13-18)25(34)31-15-9-14-19(31)23(33)28-24-20(29-30-35-24)17-10-5-3-6-11-17/h3,5-6,10-11,16,18-19,21,26H,4,7-9,12-15H2,1-2H3,(H,27,32)(H,28,33)/t16-,19-,21-/m0/s1 |
| InChIKey | WZRFLSDVFPIXOV-LRQRDZAKSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| gdc-0152 (CHEBI:750414) has role antineoplastic agent (CHEBI:35610) |
| gdc-0152 (CHEBI:750414) is a polypeptide (CHEBI:15841) |
| Synonym | Source |
|---|---|
| Gdc-0152 | ChEMBL |
| Citations |
|---|