EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C60H63N13O13S6 |
| Net Charge | 0 |
| Average Mass | 1366.644 |
| Monoisotopic Mass | 1365.29926 |
| SMILES | [H][C@@]1([C@@H](O)c2ccccc2)NC(=O)CNC(=O)c2nc(sc2COC)[C@H](C(C)C)NC(=O)c2nc(sc2C)[C@H](CC(=O)NC)NC(=O)c2csc(n2)-c2ccc(-c3nc(N(CCCCC(=O)O)C(=O)O[C@H]4CC[C@H](C(=O)O)CC4)cs3)nc2-c2csc(n2)-c2csc1n2 |
| InChI | InChI=1S/C60H63N13O13S6/c1-28(2)44-58-72-47(39(92-58)23-85-5)51(80)62-22-42(75)69-48(49(78)30-11-7-6-8-12-30)57-67-38(26-89-57)55-65-36(24-88-55)46-33(53-66-37(25-87-53)50(79)64-35(21-41(74)61-4)56-71-45(29(3)91-56)52(81)70-44)18-19-34(63-46)54-68-40(27-90-54)73(20-10-9-13-43(76)77)60(84)86-32-16-14-31(15-17-32)59(82)83/h6-8,11-12,18-19,24-28,31-32,35,44,48-49,78H,9-10,13-17,20-23H2,1-5H3,(H,61,74)(H,62,80)(H,64,79)(H,69,75)(H,70,81)(H,76,77)(H,82,83)/t31-,32-,35-,44-,48-,49-/m0/s1 |
| InChIKey | GNLYKLDXQZHYTR-LMOGNUDZSA-N |
| Roles Classification |
|---|
| Biological Role: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lff-571 (CHEBI:750413) has functional parent β-amino acid (CHEBI:33706) |
| lff-571 (CHEBI:750413) has role antibacterial agent (CHEBI:33282) |
| lff-571 (CHEBI:750413) is a organonitrogen compound (CHEBI:35352) |
| lff-571 (CHEBI:750413) is a organooxygen compound (CHEBI:36963) |
| Synonyms | Source |
|---|---|
| J3.333.591A | ChEMBL |
| Lff-571 | ChEMBL |
| LFF571 | ChEMBL |
| Citations |
|---|