EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H13NO2.C4H6O6 |
| Net Charge | 0 |
| Average Mass | 317.294 |
| Monoisotopic Mass | 317.11107 |
| SMILES | CNC[C@H](O)c1cccc(O)c1.O=C(O)C(O)C(O)C(=O)O |
| InChI | InChI=1S/C9H13NO2.C4H6O6/c1-10-6-9(12)7-3-2-4-8(11)5-7;5-1(3(7)8)2(6)4(9)10/h2-5,9-12H,6H2,1H3;1-2,5-6H,(H,7,8)(H,9,10)/t9-;/m0./s1 |
| InChIKey | NHKOTKKHHYKARN-FVGYRXGTSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Applications: | nasal decongestant A drug used to relieve nasal congestion in the upper respiratory tract. antitussive An agent that suppresses cough. Antitussives have a central or a peripheral action on the cough reflex, or a combination of both. Compare with expectorants, which are considered to increase the volume of secretions in the respiratory tract, so facilitating their removal by ciliary action and coughing, and mucolytics, which decrease the viscosity of mucus, facilitating its removal by ciliary action and expectoration. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| phenylephrine bitartrate (CHEBI:750407) has role antitussive (CHEBI:51177) |
| phenylephrine bitartrate (CHEBI:750407) has role nasal decongestant (CHEBI:77715) |
| phenylephrine bitartrate (CHEBI:750407) is a 3-hydroxy carboxylic acid (CHEBI:61355) |
| Synonyms | Source |
|---|---|
| Phenylephrine acid tartrate | ChEMBL |
| Phenylephrine hydrogen tartrate | ChEMBL |
| Brand Name | Source |
|---|---|
| Phenylephrine bitartrate component of duo-medihaler | ChEMBL |