EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C43H45ClN4O6 |
| Net Charge | 0 |
| Average Mass | 749.308 |
| Monoisotopic Mass | 748.30276 |
| SMILES | COc1cc(C(=O)C(=O)N(C)[C@@H](Cc2ccc(Cl)cc2)C(=O)N(Cc2ccccc2)C(CCc2ccncc2)CCc2ccncc2)cc(OC)c1OC |
| InChI | InChI=1S/C43H45ClN4O6/c1-47(43(51)40(49)34-27-38(52-2)41(54-4)39(28-34)53-3)37(26-32-10-14-35(44)15-11-32)42(50)48(29-33-8-6-5-7-9-33)36(16-12-30-18-22-45-23-19-30)17-13-31-20-24-46-25-21-31/h5-11,14-15,18-25,27-28,36-37H,12-13,16-17,26,29H2,1-4H3/t37-/m0/s1 |
| InChIKey | MQSMWZHHUGSULF-QNGWXLTQSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| timcodar (CHEBI:750403) has role antineoplastic agent (CHEBI:35610) |
| timcodar (CHEBI:750403) is a phenylalanine derivative (CHEBI:25985) |
| INN | Source |
|---|---|
| timcodar | WHO MedNet |
| Synonym | Source |
|---|---|
| VX-853 | ChEMBL |
| Citations |
|---|