EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:750397 - flutafuranol
| Formula | C14H11FN2O2 |
| Net Charge | 0 |
| Average Mass | 258.252 |
| Monoisotopic Mass | 258.08046 |
| SMILES | CNc1ccc(-c2cc3cc(O)ccc3o2)c(F)n1 |
| InChI | InChI=1S/C14H11FN2O2/c1-16-13-5-3-10(14(15)17-13)12-7-8-6-9(18)2-4-11(8)19-12/h2-7,18H,1H3,(H,16,17) |
| InChIKey | MYNQXTDIPMCJCR-UHFFFAOYSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| flutafuranol (CHEBI:750397) is a benzofurans (CHEBI:35259) |
| Synonyms | Source |
|---|---|
| Azd-4694 | ChEMBL |
| AZD4694 | ChEMBL |
| Citations |
|---|