EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H38N4O6S |
| Net Charge | 0 |
| Average Mass | 606.745 |
| Monoisotopic Mass | 606.25121 |
| SMILES | COc1ccc2c(c1)C=C1Cn3c-2c(C2CCCCC2)c2ccc(cc23)C(=O)NS(=O)(=O)N(C)CCOCCN(C)C1=O |
| InChI | InChI=1S/C32H38N4O6S/c1-34-13-15-42-16-14-35(2)43(39,40)33-31(37)22-9-11-27-28(19-22)36-20-24(32(34)38)17-23-18-25(41-3)10-12-26(23)30(36)29(27)21-7-5-4-6-8-21/h9-12,17-19,21H,4-8,13-16,20H2,1-3H3,(H,33,37) |
| InChIKey | UOBYJVFBFSLCTQ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | antiviral agent A substance that destroys or inhibits replication of viruses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tmc-647055 (CHEBI:750396) has role antiviral agent (CHEBI:22587) |
| tmc-647055 (CHEBI:750396) is a benzazepine (CHEBI:35676) |
| Synonyms | Source |
|---|---|
| Tmc-647055 | ChEMBL |
| TMC647055 | ChEMBL |
| Citations |
|---|