EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H18ClNO4S |
| Net Charge | 0 |
| Average Mass | 379.865 |
| Monoisotopic Mass | 379.06451 |
| SMILES | COC(=O)[C@H](c1ccccc1Cl)N1CCc2sc(OC(C)=O)cc2C1 |
| InChI | InChI=1S/C18H18ClNO4S/c1-11(21)24-16-9-12-10-20(8-7-15(12)25-16)17(18(22)23-2)13-5-3-4-6-14(13)19/h3-6,9,17H,7-8,10H2,1-2H3/t17-/m0/s1 |
| InChIKey | GNHHCBSBCDGWND-KRWDZBQOSA-N |
| Roles Classification |
|---|
| Applications: | cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sumecigrel (CHEBI:750395) has role antineoplastic agent (CHEBI:35610) |
| sumecigrel (CHEBI:750395) has role cardiovascular drug (CHEBI:35554) |
| sumecigrel (CHEBI:750395) is a α-amino acid ester (CHEBI:46874) |
| INN | Source |
|---|---|
| sumecigrel | WHO MedNet |
| Synonym | Source |
|---|---|
| Vicagrel | ChEMBL |
| Citations |
|---|