EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:750394 - mmv-048
| Formula | C18H14F3N3O2S |
| Net Charge | 0 |
| Average Mass | 393.390 |
| Monoisotopic Mass | 393.07588 |
| SMILES | CS(=O)(=O)c1ccc(-c2cnc(N)c(-c3ccc(C(F)(F)F)nc3)c2)cc1 |
| InChI | InChI=1S/C18H14F3N3O2S/c1-27(25,26)14-5-2-11(3-6-14)13-8-15(17(22)24-10-13)12-4-7-16(23-9-12)18(19,20)21/h2-10H,1H3,(H2,22,24) |
| InChIKey | RTJQABCNNLMCJF-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | antimalarial A drug used in the treatment of malaria. Antimalarials are usually classified on the basis of their action against Plasmodia at different stages in their life cycle in the human. |
| Application: | antimalarial A drug used in the treatment of malaria. Antimalarials are usually classified on the basis of their action against Plasmodia at different stages in their life cycle in the human. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| mmv-048 (CHEBI:750394) has role antimalarial (CHEBI:38068) |
| mmv-048 (CHEBI:750394) is a bipyridines (CHEBI:50511) |
| Synonyms | Source |
|---|---|
| J3.367.891F | ChEMBL |
| MMV-048 | ChEMBL |
| MMV048 | ChEMBL |
| Mmv390048 | ChEMBL |
| MMV-390048 | ChEMBL |
| Citations |
|---|