EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H16N2O4 |
| Net Charge | 0 |
| Average Mass | 276.292 |
| Monoisotopic Mass | 276.11101 |
| SMILES | CC1(CCCc2cc(=O)oc3nc(=O)nc(=O)c23)CC1 |
| InChI | InChI=1S/C14H16N2O4/c1-14(5-6-14)4-2-3-8-7-9(17)20-12-10(8)11(18)15-13(19)16-12/h7H,2-6H2,1H3,(H2,15,16,18,19) |
| InChIKey | ARJKMWXLIHZLQZ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sch-900271 (CHEBI:750392) is a 9,11,15-octadecatrienoic acid (CHEBI:38387) |
| Synonyms | Source |
|---|---|
| Sch-900271 | ChEMBL |
| SCH 900271 | ChEMBL |
| Citations |
|---|