EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H12N2O2Se2 |
| Net Charge | 0 |
| Average Mass | 422.204 |
| Monoisotopic Mass | 423.92292 |
| SMILES | O=c1c2ccccc2[se]n1CCn1[se]c2ccccc2c1=O |
| InChI | InChI=1S/C16H12N2O2Se2/c19-15-11-5-1-3-7-13(11)21-17(15)9-10-18-16(20)12-6-2-4-8-14(12)22-18/h1-8H,9-10H2 |
| InChIKey | SFFSGPCYJCMDJM-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ethaselen (CHEBI:750390) has role antineoplastic agent (CHEBI:35610) |
| ethaselen (CHEBI:750390) is a benzenoid aromatic compound (CHEBI:33836) |
| Synonyms | Source |
|---|---|
| Bbske | ChEMBL |
| Compound eb | ChEMBL |
| Ethaselen | ChEMBL |
| Ethaselen-1 | ChEMBL |
| Shuang-xi-zuo-wan-1 | ChEMBL |
| Citations |
|---|