EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H11O5 |
| Net Charge | 0 |
| Average Mass | 181.150 |
| Monoisotopic Mass | 181.06159 |
| SMILES | OC[C@H]1OC(O)[C@H]([18F])[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C6H11FO5/c7-3-5(10)4(9)2(1-8)12-6(3)11/h2-6,8-11H,1H2/t2-,3-,4-,5-,6?/m1/s1/i7-1 |
| InChIKey | ZCXUVYAZINUVJD-GLCXRVCCSA-N |
| Roles Classification |
|---|
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. antifibrotic agent Any agent which acts to reduce fibrosis. antirheumatic drug A drug used to treat rheumatoid arthritis. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fludeoxyglucose f 18 (CHEBI:750387) has role antifibrotic agent (CHEBI:233423) |
| fludeoxyglucose f 18 (CHEBI:750387) has role antineoplastic agent (CHEBI:35610) |
| fludeoxyglucose f 18 (CHEBI:750387) has role antirheumatic drug (CHEBI:35842) |
| fludeoxyglucose f 18 (CHEBI:750387) has role cardiovascular drug (CHEBI:35554) |
| fludeoxyglucose f 18 (CHEBI:750387) is a monosaccharide (CHEBI:35381) |
| INNs | Source |
|---|---|
| fludesoxiglucosa (18f) | WHO MedNet |
| fludesoxyglucose (18f) | WHO MedNet |
| Synonyms | Source |
|---|---|
| 18-FDG | ChEMBL |
| 18FDG | ChEMBL |
| (18f)-fdg | ChEMBL |
| (18f)fdg | ChEMBL |
| 18-f fdg | ChEMBL |
| 18f-fdg | ChEMBL |
| Citations |
|---|