EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H22F3N5O5 |
| Net Charge | 0 |
| Average Mass | 517.464 |
| Monoisotopic Mass | 517.15730 |
| SMILES | COc1cc2ncnc(Oc3cccc(NC(=O)Nc4cc(C(C)(C)C(F)(F)F)on4)c3)c2cc1OC |
| InChI | InChI=1S/C24H22F3N5O5/c1-23(2,24(25,26)27)19-11-20(32-37-19)31-22(33)30-13-6-5-7-14(8-13)36-21-15-9-17(34-3)18(35-4)10-16(15)28-12-29-21/h5-12H,1-4H3,(H2,30,31,32,33) |
| InChIKey | DKNUPRMJNUQNHR-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cep-32496 (CHEBI:750385) has role antineoplastic agent (CHEBI:35610) |
| cep-32496 (CHEBI:750385) is a aromatic ether (CHEBI:35618) |
| INN | Source |
|---|---|
| agerafenib | WHO MedNet |
| Synonyms | Source |
|---|---|
| AB-024 | ChEMBL |
| AC-013773 | ChEMBL |
| CEP-32496 | ChEMBL |
| Rxdx 105 | ChEMBL |
| RXDX-105 | ChEMBL |
| Citations |
|---|