EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C40H63N15O13 |
| Net Charge | 0 |
| Average Mass | 962.036 |
| Monoisotopic Mass | 961.47298 |
| SMILES | [H][C@@]12CCCN1C(=O)[C@H](CO)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](C(C)C)NC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](Cc1cncn1)NC(=O)[C@H](CCC(=O)O)NC2=O |
| InChI | InChI=1S/C40H63N15O13/c1-19(2)31-38(67)51-23(8-11-29(42)58)34(63)53-26(17-56)39(68)55-14-4-6-27(55)37(66)50-24(9-12-30(59)60)33(62)52-25(15-20-16-45-18-47-20)36(65)49-22(7-10-28(41)57)32(61)48-21(35(64)54-31)5-3-13-46-40(43)44/h16,18-19,21-27,31,56H,3-15,17H2,1-2H3,(H2,41,57)(H2,42,58)(H,45,47)(H,48,61)(H,49,65)(H,50,66)(H,51,67)(H,52,62)(H,53,63)(H,54,64)(H,59,60)(H4,43,44,46)/t21-,22-,23-,24-,25-,26-,27-,31-/m0/s1 |
| InChIKey | JXPWLIYXIWGWSA-CLBRJLNISA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | hypoglycemic agent A drug which lowers the blood glucose level. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| livoletide (CHEBI:750384) has role hypoglycemic agent (CHEBI:35526) |
| livoletide (CHEBI:750384) is a oligopeptide (CHEBI:25676) |
| INNs | Source |
|---|---|
| livoletida | WHO MedNet |
| livoletide | WHO MedNet |
| Synonyms | Source |
|---|---|
| AZP 531 | ChEMBL |
| AZP-531 | ChEMBL |
| AZP531 | ChEMBL |
| Citations |
|---|