EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H30ClN7O2S |
| Net Charge | 0 |
| Average Mass | 516.071 |
| Monoisotopic Mass | 515.18702 |
| SMILES | CN1CCN(Cc2ccc(Nc3ncc(Cl)c(Nc4ccccc4S(=O)(=O)N(C)C)n3)cc2)CC1 |
| InChI | InChI=1S/C24H30ClN7O2S/c1-30(2)35(33,34)22-7-5-4-6-21(22)28-23-20(25)16-26-24(29-23)27-19-10-8-18(9-11-19)17-32-14-12-31(3)13-15-32/h4-11,16H,12-15,17H2,1-3H3,(H2,26,27,28,29) |
| InChIKey | YUAALFPUEOYPNX-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dubermatinib (CHEBI:750377) has role antineoplastic agent (CHEBI:35610) |
| dubermatinib (CHEBI:750377) is a sulfonamide (CHEBI:35358) |
| INN | Source |
|---|---|
| dubermatinib | WHO MedNet |
| Synonyms | Source |
|---|---|
| HCl-2084 | ChEMBL |
| Tp 0903 | ChEMBL |
| TP-0903 | ChEMBL |
| TP0903 | ChEMBL |
| Citations |
|---|