EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H27FN2O4 |
| Net Charge | 0 |
| Average Mass | 414.477 |
| Monoisotopic Mass | 414.19549 |
| SMILES | CCc1c(C)cc(C(=O)NC2(C(=O)O)CCCCC2)c(=O)n1Cc1ccc(F)cc1 |
| InChI | InChI=1S/C23H27FN2O4/c1-3-19-15(2)13-18(20(27)25-23(22(29)30)11-5-4-6-12-23)21(28)26(19)14-16-7-9-17(24)10-8-16/h7-10,13H,3-6,11-12,14H2,1-2H3,(H,25,27)(H,29,30) |
| InChIKey | JIYXOJFSPOFZPY-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Application: | dermatologic drug A drug used to treat or prevent skin disorders or for the routine care of skin. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| s-777469 (CHEBI:750374) has role dermatologic drug (CHEBI:50177) |
| s-777469 (CHEBI:750374) is a N-acyl-amino acid (CHEBI:51569) |
| Synonym | Source |
|---|---|
| S-777469 | ChEMBL |
| Citations |
|---|