EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H32BrF3N8O |
| Net Charge | 0 |
| Average Mass | 609.495 |
| Monoisotopic Mass | 608.18345 |
| SMILES | Cc1c(NCCN2CCCC2)cc(C(=O)CCC(F)(F)F)cc1N1CCN(c2ncnc3nnc(Br)c23)CC1 |
| InChI | InChI=1S/C26H32BrF3N8O/c1-17-19(31-6-9-36-7-2-3-8-36)14-18(21(39)4-5-26(28,29)30)15-20(17)37-10-12-38(13-11-37)25-22-23(27)34-35-24(22)32-16-33-25/h14-16,31H,2-13H2,1H3,(H,32,33,34,35) |
| InChIKey | IKBSEBRGSVFUHM-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| xl-418 (CHEBI:750372) has role antineoplastic agent (CHEBI:35610) |
| xl-418 (CHEBI:750372) is a aromatic ketone (CHEBI:76224) |
| Synonyms | Source |
|---|---|
| Xl-418 | ChEMBL |
| XL418 | ChEMBL |
| Citations |
|---|