EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:750371 - vedroprevir
| Formula | C45H60ClN7O9S |
| Net Charge | 0 |
| Average Mass | 910.535 |
| Monoisotopic Mass | 909.38618 |
| SMILES | [H][C@]1(OC(=O)N[C@]([H])(C(=O)N2C[C@]([H])(Oc3cc(-c4csc(NC(C)C)n4)nc4c(Cl)c(OCCN5CCOCC5)ccc34)C[C@@]2([H])C(=O)N[C@]2(C(=O)O)C[C@@]2([H])CC)C(C)(C)C)C[C@@]2([H])C[C@@]2([H])C1 |
| InChI | InChI=1S/C45H60ClN7O9S/c1-7-27-21-45(27,41(56)57)51-39(54)33-19-29(22-53(33)40(55)38(44(4,5)6)50-43(58)62-28-17-25-16-26(25)18-28)61-35-20-31(32-23-63-42(49-32)47-24(2)3)48-37-30(35)8-9-34(36(37)46)60-15-12-52-10-13-59-14-11-52/h8-9,20,23-29,33,38H,7,10-19,21-22H2,1-6H3,(H,47,49)(H,50,58)(H,51,54)(H,56,57)/t25-,26+,27-,28+,29-,33+,38-,45-/m1/s1 |
| InChIKey | OTXAMWFYPMNDME-FQQWJMKMSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | antiviral agent A substance that destroys or inhibits replication of viruses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| vedroprevir (CHEBI:750371) has role antiviral agent (CHEBI:22587) |
| vedroprevir (CHEBI:750371) is a oligopeptide (CHEBI:25676) |
| INN | Source |
|---|---|
| vedroprevir | WHO MedNet |
| Synonym | Source |
|---|---|
| GS-9451 | ChEMBL |
| Citations |
|---|