EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H27N7O |
| Net Charge | 0 |
| Average Mass | 477.572 |
| Monoisotopic Mass | 477.22771 |
| SMILES | CC(C)Cn1c2ccc(Nc3ncccn3)cc2c2c3c(c4c(c21)CCc1nn(C)cc1-4)C(=O)NC3 |
| InChI | InChI=1S/C28H27N7O/c1-15(2)13-35-22-8-5-16(32-28-29-9-4-10-30-28)11-18(22)24-19-12-31-27(36)25(19)23-17(26(24)35)6-7-21-20(23)14-34(3)33-21/h4-5,8-11,14-15H,6-7,12-13H2,1-3H3,(H,31,36)(H,29,30,32) |
| InChIKey | AEULIVPVIDOLIN-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cep-11981 (CHEBI:750369) has role antineoplastic agent (CHEBI:35610) |
| cep-11981 (CHEBI:750369) is a organic heterotetracyclic compound (CHEBI:38163) |
| cep-11981 (CHEBI:750369) is a organonitrogen heterocyclic compound (CHEBI:38101) |
| Synonyms | Source |
|---|---|
| BOL-303213X | ChEMBL |
| Cep 11981 | ChEMBL |
| CEP-11981 | ChEMBL |
| CEP11981 | ChEMBL |
| Citations |
|---|