EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | HCl.C20H24N2OS |
| Net Charge | 0 |
| Average Mass | 376.953 |
| Monoisotopic Mass | 376.13761 |
| SMILES | CCN(CC)CCNc1ccc(C)c2sc3ccccc3c(=O)c12.Cl |
| InChI | InChI=1S/C20H24N2OS.ClH/c1-4-22(5-2)13-12-21-16-11-10-14(3)20-18(16)19(23)15-8-6-7-9-17(15)24-20;/h6-11,21H,4-5,12-13H2,1-3H3;1H |
| InChIKey | LAOOXBLMIJHMFO-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lucanthone hydrochloride (CHEBI:750361) has role antineoplastic agent (CHEBI:35610) |
| lucanthone hydrochloride (CHEBI:750361) is a thiochromane (CHEBI:50747) |
| Synonyms | Source |
|---|---|
| 79 T61 | ChEMBL |
| 79-T61 | ChEMBL |
| Miracil d | ChEMBL |
| Miracol | ChEMBL |
| MS-752 | ChEMBL |
| Nilodin | ChEMBL |
| Citations |
|---|