EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H24N6O2 |
| Net Charge | 0 |
| Average Mass | 452.518 |
| Monoisotopic Mass | 452.19607 |
| SMILES | CC(C)NC(=O)COc1cccc(-c2nc(Nc3ccc4nncc4c3)c3ccccc3n2)c1 |
| InChI | InChI=1S/C26H24N6O2/c1-16(2)28-24(33)15-34-20-7-5-6-17(13-20)25-30-23-9-4-3-8-21(23)26(31-25)29-19-10-11-22-18(12-19)14-27-32-22/h3-14,16H,15H2,1-2H3,(H,27,32)(H,28,33)(H,29,30,31) |
| InChIKey | GKHIVNAUVKXIIY-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | antifibrotic agent Any agent which acts to reduce fibrosis. antipsoriatic A drug used to treat psoriasis. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| belumosudil (CHEBI:750359) has role antifibrotic agent (CHEBI:233423) |
| belumosudil (CHEBI:750359) has role antineoplastic agent (CHEBI:35610) |
| belumosudil (CHEBI:750359) has role antipsoriatic (CHEBI:50748) |
| belumosudil (CHEBI:750359) is a quinazolines (CHEBI:38530) |
| Synonyms | Source |
|---|---|
| Belumosudil | ChEMBL |
| KD-025 | ChEMBL |
| KD025 | ChEMBL |
| Rock2 inhibitor kd025 | ChEMBL |
| Slx-2119 free base | ChEMBL |
| Citations |
|---|