EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H11N3O2 |
| Net Charge | 0 |
| Average Mass | 181.195 |
| Monoisotopic Mass | 181.08513 |
| SMILES | NC(=O)CN1C=CCC(C(N)=O)=C1 |
| InChI | InChI=1S/C8H11N3O2/c9-7(12)5-11-3-1-2-6(4-11)8(10)13/h1,3-4H,2,5H2,(H2,9,12)(H2,10,13) |
| InChIKey | WEJRSYKFMCUCRQ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| caricotamide (CHEBI:750355) has role antineoplastic agent (CHEBI:35610) |
| caricotamide (CHEBI:750355) is a amino acid amide (CHEBI:22475) |
| INNs | Source |
|---|---|
| caricotamida | WHO MedNet |
| caricotamide | WHO MedNet |